C20H22FN3O3 — CID 15382909
1-cyclopropyl-7-(3-ethenylpiperazin-1-yl)-6-fluoro-5-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 15382909) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 1-cyclopropyl-7-(3-ethenylpiperazin-1-yl)-6-fluoro-5-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-(3-ethenylpiperazin-1-yl)-6-fluoro-5-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 15382909 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-cyclopropyl-7-(3-ethenylpiperazin-1-yl)-6-fluoro-5-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | C=CC1CN(c2cc3c(c(C)c2F)c(=O)c(C(=O)O)cn3C2CC2)CCN1 |
| InChI | InChI=1S/C20H22FN3O3/c1-3-12-9-23(7-6-22-12)16-8-15-17(11(2)18(16)21)19(25)14(20(26)27)10-24(15)13-4-5-13/h3,8,10,12-13,22H,1,4-7,9H2,2H3,(H,26,27) |
| InChIKey | ALKCOPVILXIFBO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|