About 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one
8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one (PubChem CID 15383053) has the molecular formula C7H7ClO3
and a molecular weight of 174.58 g/mol. Its IUPAC name is 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one.
Molecular Properties
| Compound Name | 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one |
| PubChem CID | 15383053 |
| Molecular Formula | C7H7ClO3 |
| Molecular Weight | 174.58 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one |
| SMILES | O=C1CC2(C=C1Cl)OCCO2 |
| InChI | InChI=1S/C7H7ClO3/c8-5-3-7(4-6(5)9)10-1-2-11-7/h3H,1-2,4H2 |
| InChIKey | AUZGEYRGJUNAHN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.58 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one?
The IUPAC name of 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one (CID 15383053) is 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one.
What is the SMILES notation for 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one?
The canonical SMILES for 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one is O=C1CC2(C=C1Cl)OCCO2.
What is the InChIKey of 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one?
The InChIKey is AUZGEYRGJUNAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO3/c8-5-3-7(4-6(5)9)10-1-2-11-7/h3H,1-2,4H2.
What are the key properties of 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one?
8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one has a molecular weight of 174.58 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1,4-dioxaspiro[4.4]non-8-en-7-one is sourced from PubChem (CID 15383053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).