benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate

C18H19NO2 — CID 15383608

IUPACbenzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate
SMILESC[C@H](/C=C/c1ccccc1)NC(=O)OCc1ccccc1
InChIInChI=1S/C18H19NO2/c1-15(12-13-16-8-4-2-5-9-16)19-18(20)21-14-17-10-6-3-7-11-17/h2-13,15H,14H2,1H3,(H,19,20)/b13-12+/t15-/m1/s1
InChIKeyFUJBLECUANWUNI-RDRICISKSA-N
MW281.36 g/mol
LogP4.01
Rot. Bonds5

About benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate

benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate (PubChem CID 15383608) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate.

Molecular Properties

Compound Namebenzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate
PubChem CID15383608
Molecular FormulaC18H19NO2
Molecular Weight281.36 g/mol
Exact Mass281.14
IUPAC Namebenzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate
SMILESC[C@H](/C=C/c1ccccc1)NC(=O)OCc1ccccc1
InChIInChI=1S/C18H19NO2/c1-15(12-13-16-8-4-2-5-9-16)19-18(20)21-14-17-10-6-3-7-11-17/h2-13,15H,14H2,1H3,(H,19,20)/b13-12+/t15-/m1/s1
InChIKeyFUJBLECUANWUNI-RDRICISKSA-N
XLogP4.01
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.36
LogP ≤ 54.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate?
The IUPAC name of benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate (CID 15383608) is benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate.
What is the SMILES notation for benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate?
The canonical SMILES for benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate is C[C@H](/C=C/c1ccccc1)NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate?
The InChIKey is FUJBLECUANWUNI-RDRICISKSA-N. The full InChI is InChI=1S/C18H19NO2/c1-15(12-13-16-8-4-2-5-9-16)19-18(20)21-14-17-10-6-3-7-11-17/h2-13,15H,14H2,1H3,(H,19,20)/b13-12+/t15-/m1/s1.
What are the key properties of benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate?
benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate has a molecular weight of 281.36 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(E,2R)-4-phenylbut-3-en-2-yl]carbamate is sourced from PubChem (CID 15383608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).