C40H45NO5 — CID 15384305
(3aS,4R,6R,6aR)-5-benzyl-4-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 15384305) has the molecular formula C40H45NO5 and a molecular weight of 619.80 g/mol. Its IUPAC name is (3aS,4R,6R,6aR)-5-benzyl-4-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,4R,6R,6aR)-5-benzyl-4-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 15384305 |
| Molecular Formula | C40H45NO5 |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | (3aS,4R,6R,6aR)-5-benzyl-4-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | C=CC[C@H](OCOC)[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C40H45NO5/c1-5-18-35(43-29-42-4)36-38-37(45-39(2,3)46-38)34(41(36)27-30-19-10-6-11-20-30)28-44-40(31-21-12-7-13-22-31,32-23-14-8-15-24-32)33-25-16-9-17-26-33/h5-17,19-26,34-38H,1,18,27-29H2,2-4H3/t34-,35+,36-,37-,38+/m1/s1 |
| InChIKey | SATMHPWIDJNRIL-GSPXPSQGSA-N |
| XLogP | 7.33 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|