C34H34N2O5 — CID 15384541
benzyl N-[(1S)-2-phenyl-1-[(2R,3R)-3-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]oxiran-2-yl]ethyl]carbamate (PubChem CID 15384541) has the molecular formula C34H34N2O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is benzyl N-[(1S)-2-phenyl-1-[(2R,3R)-3-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]oxiran-2-yl]ethyl]carbamate.
| Compound Name | benzyl N-[(1S)-2-phenyl-1-[(2R,3R)-3-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]oxiran-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 15384541 |
| Molecular Formula | C34H34N2O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | benzyl N-[(1S)-2-phenyl-1-[(2R,3R)-3-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]oxiran-2-yl]ethyl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H]1O[C@@H]1[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H34N2O5/c37-33(39-23-27-17-9-3-10-18-27)35-29(21-25-13-5-1-6-14-25)31-32(41-31)30(22-26-15-7-2-8-16-26)36-34(38)40-24-28-19-11-4-12-20-28/h1-20,29-32H,21-24H2,(H,35,37)(H,36,38)/t29-,30-,31+,32+/m0/s1 |
| InChIKey | QHFYQDPHHYSUFT-GASGPIRDSA-N |
| XLogP | 5.83 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|