C15H21Br2ClO — CID 15385253
(6R,8S,9S,11S)-4,8-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-dien-11-ol (PubChem CID 15385253) has the molecular formula C15H21Br2ClO and a molecular weight of 412.59 g/mol. Its IUPAC name is (6R,8S,9S,11S)-4,8-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-dien-11-ol.
| Compound Name | (6R,8S,9S,11S)-4,8-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-dien-11-ol |
|---|---|
| PubChem CID | 15385253 |
| Molecular Formula | C15H21Br2ClO |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | (6R,8S,9S,11S)-4,8-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undeca-1,3-dien-11-ol |
| SMILES | CC1=CC=C(Br)C(C)(C)[C@@]12C[C@H](Br)[C@@](C)(Cl)C[C@@H]2O |
| InChI | InChI=1S/C15H21Br2ClO/c1-9-5-6-10(16)13(2,3)15(9)7-11(17)14(4,18)8-12(15)19/h5-6,11-12,19H,7-8H2,1-4H3/t11-,12-,14-,15-/m0/s1 |
| InChIKey | TUPUUXBXXLYXLR-JURCDPSOSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|