C14H20O — CID 15385843
(1S,3aS,7aR)-1-ethenyl-7a-methyl-5-propan-2-ylidene-1,3,3a,4-tetrahydro-2-benzofuran (PubChem CID 15385843) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1S,3aS,7aR)-1-ethenyl-7a-methyl-5-propan-2-ylidene-1,3,3a,4-tetrahydro-2-benzofuran.
| Compound Name | (1S,3aS,7aR)-1-ethenyl-7a-methyl-5-propan-2-ylidene-1,3,3a,4-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 15385843 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1S,3aS,7aR)-1-ethenyl-7a-methyl-5-propan-2-ylidene-1,3,3a,4-tetrahydro-2-benzofuran |
| SMILES | C=C[C@@H]1OC[C@H]2CC(=C(C)C)C=C[C@]21C |
| InChI | InChI=1S/C14H20O/c1-5-13-14(4)7-6-11(10(2)3)8-12(14)9-15-13/h5-7,12-13H,1,8-9H2,2-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | XKAOIMPCAIKCOE-HZSPNIEDSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|