C22H28O4 — CID 15385947
[(3R,3aS,4S)-3-hydroxy-1,6-dimethyl-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-hydroxybenzoate (PubChem CID 15385947) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(3R,3aS,4S)-3-hydroxy-1,6-dimethyl-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-hydroxybenzoate.
| Compound Name | [(3R,3aS,4S)-3-hydroxy-1,6-dimethyl-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 15385947 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(3R,3aS,4S)-3-hydroxy-1,6-dimethyl-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-hydroxybenzoate |
| SMILES | CC1=CCC2=C(C)C[C@@](O)(C(C)C)[C@@H]2[C@@H](OC(=O)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C22H28O4/c1-13(2)22(25)12-15(4)18-10-5-14(3)11-19(20(18)22)26-21(24)16-6-8-17(23)9-7-16/h5-9,13,19-20,23,25H,10-12H2,1-4H3/t19-,20-,22+/m0/s1 |
| InChIKey | AGZOKBAZGMQQRQ-JAXLGGSGSA-N |
| XLogP | 4.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|