C18H32O7 — CID 15385956
(E,6S,7S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6,7-bis(methoxymethoxy)-4,4-dimethylhept-2-enal (PubChem CID 15385956) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is (E,6S,7S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6,7-bis(methoxymethoxy)-4,4-dimethylhept-2-enal.
| Compound Name | (E,6S,7S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6,7-bis(methoxymethoxy)-4,4-dimethylhept-2-enal |
|---|---|
| PubChem CID | 15385956 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (E,6S,7S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6,7-bis(methoxymethoxy)-4,4-dimethylhept-2-enal |
| SMILES | COCO[C@@H]([C@H](CC(C)(C)/C=C/C=O)OCOC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H32O7/c1-17(2,8-7-9-19)10-14(22-12-20-5)16(23-13-21-6)15-11-24-18(3,4)25-15/h7-9,14-16H,10-13H2,1-6H3/b8-7+/t14-,15+,16-/m0/s1 |
| InChIKey | MBCWFIDAZAJHHB-ZCZKIAQZSA-N |
| XLogP | 2.29 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|