C26H29NO8 — CID 15386263
[(2R)-2-[(2R,3S)-3-acetyloxy-4-oxo-1-[(1R)-1-phenylethyl]azetidin-2-yl]-2-phenylmethoxyethyl] 2-acetyloxyacetate (PubChem CID 15386263) has the molecular formula C26H29NO8 and a molecular weight of 483.52 g/mol. Its IUPAC name is [(2R)-2-[(2R,3S)-3-acetyloxy-4-oxo-1-[(1R)-1-phenylethyl]azetidin-2-yl]-2-phenylmethoxyethyl] 2-acetyloxyacetate.
| Compound Name | [(2R)-2-[(2R,3S)-3-acetyloxy-4-oxo-1-[(1R)-1-phenylethyl]azetidin-2-yl]-2-phenylmethoxyethyl] 2-acetyloxyacetate |
|---|---|
| PubChem CID | 15386263 |
| Molecular Formula | C26H29NO8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [(2R)-2-[(2R,3S)-3-acetyloxy-4-oxo-1-[(1R)-1-phenylethyl]azetidin-2-yl]-2-phenylmethoxyethyl] 2-acetyloxyacetate |
| SMILES | CC(=O)OCC(=O)OC[C@H](OCc1ccccc1)[C@@H]1[C@H](OC(C)=O)C(=O)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H29NO8/c1-17(21-12-8-5-9-13-21)27-24(25(26(27)31)35-19(3)29)22(15-34-23(30)16-32-18(2)28)33-14-20-10-6-4-7-11-20/h4-13,17,22,24-25H,14-16H2,1-3H3/t17-,22+,24-,25+/m1/s1 |
| InChIKey | SLQZXQHKRRGISZ-IMYILZHDSA-N |
| XLogP | 2.58 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|