C32H32F6N2O2 — CID 15386756
(3S,4R,5S,6S)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N-dimethyl-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 15386756) has the molecular formula C32H32F6N2O2 and a molecular weight of 590.61 g/mol. Its IUPAC name is (3S,4R,5S,6S)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N-dimethyl-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3S,4R,5S,6S)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N-dimethyl-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 15386756 |
| Molecular Formula | C32H32F6N2O2 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (3S,4R,5S,6S)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N-dimethyl-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CN2CC[C@H]1[C@H](OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32F6N2O2/c1-39(2)30(41)26-18-40-14-13-25(26)29(28(40)27(21-9-5-3-6-10-21)22-11-7-4-8-12-22)42-19-20-15-23(31(33,34)35)17-24(16-20)32(36,37)38/h3-12,15-17,25-29H,13-14,18-19H2,1-2H3/t25-,26-,28+,29+/m1/s1 |
| InChIKey | FIYHPIZFEUMWQJ-KFADFNFCSA-N |
| XLogP | 6.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |