C36H44FNO3 — CID 15386778
methyl (2S,3S,5S)-2-(cyclohexylmethyl)-3-fluoro-7-methyl-4-oxo-5-(tritylamino)octanoate (PubChem CID 15386778) has the molecular formula C36H44FNO3 and a molecular weight of 557.75 g/mol. Its IUPAC name is methyl (2S,3S,5S)-2-(cyclohexylmethyl)-3-fluoro-7-methyl-4-oxo-5-(tritylamino)octanoate.
| Compound Name | methyl (2S,3S,5S)-2-(cyclohexylmethyl)-3-fluoro-7-methyl-4-oxo-5-(tritylamino)octanoate |
|---|---|
| PubChem CID | 15386778 |
| Molecular Formula | C36H44FNO3 |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | methyl (2S,3S,5S)-2-(cyclohexylmethyl)-3-fluoro-7-methyl-4-oxo-5-(tritylamino)octanoate |
| SMILES | COC(=O)[C@H](CC1CCCCC1)[C@H](F)C(=O)[C@H](CC(C)C)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H44FNO3/c1-26(2)24-32(34(39)33(37)31(35(40)41-3)25-27-16-8-4-9-17-27)38-36(28-18-10-5-11-19-28,29-20-12-6-13-21-29)30-22-14-7-15-23-30/h5-7,10-15,18-23,26-27,31-33,38H,4,8-9,16-17,24-25H2,1-3H3/t31-,32+,33+/m1/s1 |
| InChIKey | PMMWUWCSWNAQMF-CEUYOYMZSA-N |
| XLogP | 7.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|