C30H34FNO3 — CID 15386779
methyl (2S,3S,5S)-3-fluoro-2-(2-methylpropyl)-4-oxo-5-(tritylamino)hexanoate (PubChem CID 15386779) has the molecular formula C30H34FNO3 and a molecular weight of 475.60 g/mol. Its IUPAC name is methyl (2S,3S,5S)-3-fluoro-2-(2-methylpropyl)-4-oxo-5-(tritylamino)hexanoate.
| Compound Name | methyl (2S,3S,5S)-3-fluoro-2-(2-methylpropyl)-4-oxo-5-(tritylamino)hexanoate |
|---|---|
| PubChem CID | 15386779 |
| Molecular Formula | C30H34FNO3 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | methyl (2S,3S,5S)-3-fluoro-2-(2-methylpropyl)-4-oxo-5-(tritylamino)hexanoate |
| SMILES | COC(=O)[C@H](CC(C)C)[C@H](F)C(=O)[C@H](C)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34FNO3/c1-21(2)20-26(29(34)35-4)27(31)28(33)22(3)32-30(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,21-22,26-27,32H,20H2,1-4H3/t22-,26+,27-/m0/s1 |
| InChIKey | RJZXGXRPPCXGTN-FDJWOJMMSA-N |
| XLogP | 5.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|