About S-butyl prop-2-enethioate
S-butyl prop-2-enethioate (PubChem CID 15387859) has the molecular formula C7H12OS
and a molecular weight of 144.24 g/mol. Its IUPAC name is S-butyl prop-2-enethioate.
Molecular Properties
| Compound Name | S-butyl prop-2-enethioate |
| PubChem CID | 15387859 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | S-butyl prop-2-enethioate |
| SMILES | C=CC(=O)SCCCC |
| InChI | InChI=1S/C7H12OS/c1-3-5-6-9-7(8)4-2/h4H,2-3,5-6H2,1H3 |
| InChIKey | QIKNKCITZPITLX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-butyl prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-butyl prop-2-enethioate?
The IUPAC name of S-butyl prop-2-enethioate (CID 15387859) is S-butyl prop-2-enethioate.
What is the SMILES notation for S-butyl prop-2-enethioate?
The canonical SMILES for S-butyl prop-2-enethioate is C=CC(=O)SCCCC.
What is the InChIKey of S-butyl prop-2-enethioate?
The InChIKey is QIKNKCITZPITLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS/c1-3-5-6-9-7(8)4-2/h4H,2-3,5-6H2,1H3.
What are the key properties of S-butyl prop-2-enethioate?
S-butyl prop-2-enethioate has a molecular weight of 144.24 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl prop-2-enethioate is sourced from PubChem (CID 15387859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).