C13H14F3N3O3 — CID 15388856
1-hydroxy-1-[1-[3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]ethyl]urea (PubChem CID 15388856) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is 1-hydroxy-1-[1-[3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]ethyl]urea.
| Compound Name | 1-hydroxy-1-[1-[3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]ethyl]urea |
|---|---|
| PubChem CID | 15388856 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-hydroxy-1-[1-[3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]ethyl]urea |
| SMILES | CC(C1CC(c2ccc(C(F)(F)F)cc2)=NO1)N(O)C(N)=O |
| InChI | InChI=1S/C13H14F3N3O3/c1-7(19(21)12(17)20)11-6-10(18-22-11)8-2-4-9(5-3-8)13(14,15)16/h2-5,7,11,21H,6H2,1H3,(H2,17,20) |
| InChIKey | QMDKPCDZUCKRDU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|