About 1,5-diphenylpentan-3-amine
1,5-diphenylpentan-3-amine (PubChem CID 15388874) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1,5-diphenylpentan-3-amine.
Molecular Properties
| Compound Name | 1,5-diphenylpentan-3-amine |
| PubChem CID | 15388874 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1,5-diphenylpentan-3-amine |
| SMILES | NC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C17H21N/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-10,17H,11-14,18H2 |
| InChIKey | PBKWJPMGHCRYGT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-diphenylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenylpentan-3-amine?
The IUPAC name of 1,5-diphenylpentan-3-amine (CID 15388874) is 1,5-diphenylpentan-3-amine.
What is the SMILES notation for 1,5-diphenylpentan-3-amine?
The canonical SMILES for 1,5-diphenylpentan-3-amine is NC(CCc1ccccc1)CCc1ccccc1.
What is the InChIKey of 1,5-diphenylpentan-3-amine?
The InChIKey is PBKWJPMGHCRYGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-10,17H,11-14,18H2.
What are the key properties of 1,5-diphenylpentan-3-amine?
1,5-diphenylpentan-3-amine has a molecular weight of 239.36 g/mol, XLogP of 3.58, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenylpentan-3-amine is sourced from PubChem (CID 15388874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).