C9H5F4N5 — CID 15388905
6-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 15388905) has the molecular formula C9H5F4N5 and a molecular weight of 259.17 g/mol. Its IUPAC name is 6-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 15388905 |
| Molecular Formula | C9H5F4N5 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 6-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2cc(F)c(F)c(F)c2F)c(N)n1 |
| InChI | InChI=1S/C9H5F4N5/c10-3-1-2(4(11)6(13)5(3)12)7-8(14)16-9(15)18-17-7/h1H,(H4,14,15,16,18) |
| InChIKey | VRAVMHXIPMWWOV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|