About 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine
2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine (PubChem CID 15389735) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine |
| PubChem CID | 15389735 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine |
| SMILES | c1cnc2cc([C@@H]3CCCN3)oc2c1 |
| InChI | InChI=1S/C11H12N2O/c1-3-8(12-5-1)11-7-9-10(14-11)4-2-6-13-9/h2,4,6-8,12H,1,3,5H2/t8-/m0/s1 |
| InChIKey | QULUBEZVAACGFX-QMMMGPOBSA-N |
| XLogP | 2.25 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine?
The IUPAC name of 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine (CID 15389735) is 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine.
What is the SMILES notation for 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine?
The canonical SMILES for 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine is c1cnc2cc([C@@H]3CCCN3)oc2c1.
What is the InChIKey of 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine?
The InChIKey is QULUBEZVAACGFX-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H12N2O/c1-3-8(12-5-1)11-7-9-10(14-11)4-2-6-13-9/h2,4,6-8,12H,1,3,5H2/t8-/m0/s1.
What are the key properties of 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine?
2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine has a molecular weight of 188.23 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-pyrrolidin-2-yl]furo[3,2-b]pyridine is sourced from PubChem (CID 15389735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).