About N-hexylprop-2-ynamide
N-hexylprop-2-ynamide (PubChem CID 15389945) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-hexylprop-2-ynamide.
Molecular Properties
| Compound Name | N-hexylprop-2-ynamide |
| PubChem CID | 15389945 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-hexylprop-2-ynamide |
| SMILES | C#CC(=O)NCCCCCC |
| InChI | InChI=1S/C9H15NO/c1-3-5-6-7-8-10-9(11)4-2/h2H,3,5-8H2,1H3,(H,10,11) |
| InChIKey | NPNFROVVIRURJV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hexylprop-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexylprop-2-ynamide?
The IUPAC name of N-hexylprop-2-ynamide (CID 15389945) is N-hexylprop-2-ynamide.
What is the SMILES notation for N-hexylprop-2-ynamide?
The canonical SMILES for N-hexylprop-2-ynamide is C#CC(=O)NCCCCCC.
What is the InChIKey of N-hexylprop-2-ynamide?
The InChIKey is NPNFROVVIRURJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-5-6-7-8-10-9(11)4-2/h2H,3,5-8H2,1H3,(H,10,11).
What are the key properties of N-hexylprop-2-ynamide?
N-hexylprop-2-ynamide has a molecular weight of 153.22 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexylprop-2-ynamide is sourced from PubChem (CID 15389945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).