About 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione
3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 15390075) has the molecular formula C13H9Cl2F3N2O3
and a molecular weight of 369.13 g/mol. Its IUPAC name is 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| PubChem CID | 15390075 |
| Molecular Formula | C13H9Cl2F3N2O3 |
| Molecular Weight | 369.13 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(Cc2ccc(O)c(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C13H9Cl2F3N2O3/c1-19-8(13(16,17)18)4-9(22)20(12(19)23)5-6-2-3-7(21)11(15)10(6)14/h2-4,21H,5H2,1H3 |
| InChIKey | PSTIPBHDFGJRER-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The IUPAC name of 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (CID 15390075) is 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The canonical SMILES for 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione is Cn1c(C(F)(F)F)cc(=O)n(Cc2ccc(O)c(Cl)c2Cl)c1=O.
What is the InChIKey of 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The InChIKey is PSTIPBHDFGJRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2F3N2O3/c1-19-8(13(16,17)18)4-9(22)20(12(19)23)5-6-2-3-7(21)11(15)10(6)14/h2-4,21H,5H2,1H3.
What are the key properties of 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione has a molecular weight of 369.13 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dichloro-4-hydroxyphenyl)methyl]-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 15390075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).