C36H32N5O5P3 — CID 15390195
2,4,4,6,6-pentaphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine (PubChem CID 15390195) has the molecular formula C36H32N5O5P3 and a molecular weight of 707.60 g/mol. Its IUPAC name is 2,4,4,6,6-pentaphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine.
| Compound Name | 2,4,4,6,6-pentaphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 15390195 |
| Molecular Formula | C36H32N5O5P3 |
| Molecular Weight | 707.60 g/mol |
| Exact Mass | 707.16 |
| IUPAC Name | 2,4,4,6,6-pentaphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-amine |
| SMILES | c1ccc(OP2(NCc3cccnc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C36H32N5O5P3/c1-6-18-32(19-7-1)42-47(38-30-31-17-16-28-37-29-31)39-48(43-33-20-8-2-9-21-33,44-34-22-10-3-11-23-34)41-49(40-47,45-35-24-12-4-13-25-35)46-36-26-14-5-15-27-36/h1-29,38H,30H2 |
| InChIKey | WJAHVBXKEUGKEB-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.60 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|