About [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid
[2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid (PubChem CID 15390279) has the molecular formula C7H15NO6P2
and a molecular weight of 271.15 g/mol. Its IUPAC name is [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid.
Molecular Properties
| Compound Name | [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid |
| PubChem CID | 15390279 |
| Molecular Formula | C7H15NO6P2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CN1CC=CCC1)P(=O)(O)O |
| InChI | InChI=1S/C7H15NO6P2/c9-15(10,11)7(16(12,13)14)6-8-4-2-1-3-5-8/h1-2,7H,3-6H2,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | RODXFVPJCXSOHM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid?
The IUPAC name of [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid (CID 15390279) is [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid.
What is the SMILES notation for [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid?
The canonical SMILES for [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid is O=P(O)(O)C(CN1CC=CCC1)P(=O)(O)O.
What is the InChIKey of [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid?
The InChIKey is RODXFVPJCXSOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO6P2/c9-15(10,11)7(16(12,13)14)6-8-4-2-1-3-5-8/h1-2,7H,3-6H2,(H2,9,10,11)(H2,12,13,14).
What are the key properties of [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid?
[2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid has a molecular weight of 271.15 g/mol, XLogP of -0.07, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,6-dihydro-2H-pyridin-1-yl)-1-phosphonoethyl]phosphonic acid is sourced from PubChem (CID 15390279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).