methyl 2-[butyl(methyl)amino]acetate

C8H17NO2 — CID 15390348

IUPACmethyl 2-[butyl(methyl)amino]acetate
SMILESCCCCN(C)CC(=O)OC
InChIInChI=1S/C8H17NO2/c1-4-5-6-9(2)7-8(10)11-3/h4-7H2,1-3H3
InChIKeyKDKDEZAGIOTJRJ-UHFFFAOYSA-N
MW159.23 g/mol
LogP0.89
Rot. Bonds5

About methyl 2-[butyl(methyl)amino]acetate

methyl 2-[butyl(methyl)amino]acetate (PubChem CID 15390348) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is methyl 2-[butyl(methyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[butyl(methyl)amino]acetate
PubChem CID15390348
Molecular FormulaC8H17NO2
Molecular Weight159.23 g/mol
Exact Mass159.13
IUPAC Namemethyl 2-[butyl(methyl)amino]acetate
SMILESCCCCN(C)CC(=O)OC
InChIInChI=1S/C8H17NO2/c1-4-5-6-9(2)7-8(10)11-3/h4-7H2,1-3H3
InChIKeyKDKDEZAGIOTJRJ-UHFFFAOYSA-N
XLogP0.89
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.23
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[butyl(methyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[butyl(methyl)amino]acetate?
The IUPAC name of methyl 2-[butyl(methyl)amino]acetate (CID 15390348) is methyl 2-[butyl(methyl)amino]acetate.
What is the SMILES notation for methyl 2-[butyl(methyl)amino]acetate?
The canonical SMILES for methyl 2-[butyl(methyl)amino]acetate is CCCCN(C)CC(=O)OC.
What is the InChIKey of methyl 2-[butyl(methyl)amino]acetate?
The InChIKey is KDKDEZAGIOTJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-4-5-6-9(2)7-8(10)11-3/h4-7H2,1-3H3.
What are the key properties of methyl 2-[butyl(methyl)amino]acetate?
methyl 2-[butyl(methyl)amino]acetate has a molecular weight of 159.23 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[butyl(methyl)amino]acetate is sourced from PubChem (CID 15390348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).