C31H37N5O6 — CID 15390870
[(19S)-10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoate (PubChem CID 15390870) has the molecular formula C31H37N5O6 and a molecular weight of 575.67 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoate.
| Compound Name | [(19S)-10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 15390870 |
| Molecular Formula | C31H37N5O6 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | [(19S)-10,19-diethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoate |
| SMILES | CCc1c2c(nc3ccccc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@@]3(CC)OC(=O)[C@H](C)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C31H37N5O6/c1-4-18-19-10-6-7-12-24(19)35-26-20(18)15-36-25(26)14-22-21(28(36)38)16-41-30(40)31(22,5-2)42-29(39)17(3)34-27(37)23(33)11-8-9-13-32/h6-7,10,12,14,17,23H,4-5,8-9,11,13,15-16,32-33H2,1-3H3,(H,34,37)/t17-,23-,31-/m0/s1 |
| InChIKey | WUHWVMCPBMVOFZ-OFUOLHIWSA-N |
| XLogP | 2.15 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|