About N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine
N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine (PubChem CID 15391301) has the molecular formula C11H11N5O4
and a molecular weight of 277.24 g/mol. Its IUPAC name is N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine.
Molecular Properties
| Compound Name | N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine |
| PubChem CID | 15391301 |
| Molecular Formula | C11H11N5O4 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine |
| SMILES | Cn1nc([N+](=O)[O-])c(NCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N5O4/c1-14-11(16(19)20)9(10(13-14)15(17)18)12-7-8-5-3-2-4-6-8/h2-6,12H,7H2,1H3 |
| InChIKey | DNZVFMAZLYWXHN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine?
The IUPAC name of N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine (CID 15391301) is N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine.
What is the SMILES notation for N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine?
The canonical SMILES for N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine is Cn1nc([N+](=O)[O-])c(NCc2ccccc2)c1[N+](=O)[O-].
What is the InChIKey of N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine?
The InChIKey is DNZVFMAZLYWXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O4/c1-14-11(16(19)20)9(10(13-14)15(17)18)12-7-8-5-3-2-4-6-8/h2-6,12H,7H2,1H3.
What are the key properties of N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine?
N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine has a molecular weight of 277.24 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-methyl-3,5-dinitropyrazol-4-amine is sourced from PubChem (CID 15391301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).