C7H3Cl2N3O3 — CID 15392042
5,7-dichloro-4-hydroxy-1H-pyrido[3,4-b]pyrazine-2,3-dione (PubChem CID 15392042) has the molecular formula C7H3Cl2N3O3 and a molecular weight of 248.02 g/mol. Its IUPAC name is 5,7-dichloro-4-hydroxy-1H-pyrido[3,4-b]pyrazine-2,3-dione.
| Compound Name | 5,7-dichloro-4-hydroxy-1H-pyrido[3,4-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 15392042 |
| Molecular Formula | C7H3Cl2N3O3 |
| Molecular Weight | 248.02 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 5,7-dichloro-4-hydroxy-1H-pyrido[3,4-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cc(Cl)nc(Cl)c2n(O)c1=O |
| InChI | InChI=1S/C7H3Cl2N3O3/c8-3-1-2-4(5(9)11-3)12(15)7(14)6(13)10-2/h1,15H,(H,10,13) |
| InChIKey | WJOYRXISLAPLDM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.02 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|