C21H27N3S3 — CID 15393460
1-N,3-N,5-N-tris(thiophen-2-ylmethyl)cyclohexane-1,3,5-triamine (PubChem CID 15393460) has the molecular formula C21H27N3S3 and a molecular weight of 417.67 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(thiophen-2-ylmethyl)cyclohexane-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris(thiophen-2-ylmethyl)cyclohexane-1,3,5-triamine |
|---|---|
| PubChem CID | 15393460 |
| Molecular Formula | C21H27N3S3 |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-N,3-N,5-N-tris(thiophen-2-ylmethyl)cyclohexane-1,3,5-triamine |
| SMILES | c1csc(CNC2CC(NCc3cccs3)CC(NCc3cccs3)C2)c1 |
| InChI | InChI=1S/C21H27N3S3/c1-4-19(25-7-1)13-22-16-10-17(23-14-20-5-2-8-26-20)12-18(11-16)24-15-21-6-3-9-27-21/h1-9,16-18,22-24H,10-15H2 |
| InChIKey | WYTRJBBHZRKIDP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |