About 2-cyclohexa-2,4-dien-1-ylethynylbenzene
2-cyclohexa-2,4-dien-1-ylethynylbenzene (PubChem CID 15394474) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-ylethynylbenzene.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-ylethynylbenzene |
| PubChem CID | 15394474 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-ylethynylbenzene |
| SMILES | C(#CC1C=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-9,14H,10H2 |
| InChIKey | RUJZSYNPRSOEAS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-2,4-dien-1-ylethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-ylethynylbenzene?
The IUPAC name of 2-cyclohexa-2,4-dien-1-ylethynylbenzene (CID 15394474) is 2-cyclohexa-2,4-dien-1-ylethynylbenzene.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-ylethynylbenzene?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-ylethynylbenzene is C(#CC1C=CC=CC1)c1ccccc1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-ylethynylbenzene?
The InChIKey is RUJZSYNPRSOEAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-9,14H,10H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-ylethynylbenzene?
2-cyclohexa-2,4-dien-1-ylethynylbenzene has a molecular weight of 180.25 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-ylethynylbenzene is sourced from PubChem (CID 15394474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).