About 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine
5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine (PubChem CID 15395099) has the molecular formula C7F10N2
and a molecular weight of 302.07 g/mol. Its IUPAC name is 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine |
| PubChem CID | 15395099 |
| Molecular Formula | C7F10N2 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine |
| SMILES | Fc1c(C(F)(F)F)nc(C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C7F10N2/c8-1-2(5(9,10)11)18-4(7(15,16)17)19-3(1)6(12,13)14 |
| InChIKey | TXEKTKXIQSVDCO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine?
The IUPAC name of 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine (CID 15395099) is 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine.
What is the SMILES notation for 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine?
The canonical SMILES for 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine is Fc1c(C(F)(F)F)nc(C(F)(F)F)nc1C(F)(F)F.
What is the InChIKey of 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine?
The InChIKey is TXEKTKXIQSVDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7F10N2/c8-1-2(5(9,10)11)18-4(7(15,16)17)19-3(1)6(12,13)14.
What are the key properties of 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine?
5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine has a molecular weight of 302.07 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4,6-tris(trifluoromethyl)pyrimidine is sourced from PubChem (CID 15395099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).