About 3-azido-5,6-diphenyl-1,2,4-triazine
3-azido-5,6-diphenyl-1,2,4-triazine (PubChem CID 15395171) has the molecular formula C15H10N6
and a molecular weight of 274.29 g/mol. Its IUPAC name is 3-azido-5,6-diphenyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-azido-5,6-diphenyl-1,2,4-triazine |
| PubChem CID | 15395171 |
| Molecular Formula | C15H10N6 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-azido-5,6-diphenyl-1,2,4-triazine |
| SMILES | [N-]=[N+]=Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H10N6/c16-21-20-15-17-13(11-7-3-1-4-8-11)14(18-19-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | XQSYSTZYHDEJQJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-5,6-diphenyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-5,6-diphenyl-1,2,4-triazine?
The IUPAC name of 3-azido-5,6-diphenyl-1,2,4-triazine (CID 15395171) is 3-azido-5,6-diphenyl-1,2,4-triazine.
What is the SMILES notation for 3-azido-5,6-diphenyl-1,2,4-triazine?
The canonical SMILES for 3-azido-5,6-diphenyl-1,2,4-triazine is [N-]=[N+]=Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 3-azido-5,6-diphenyl-1,2,4-triazine?
The InChIKey is XQSYSTZYHDEJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N6/c16-21-20-15-17-13(11-7-3-1-4-8-11)14(18-19-15)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 3-azido-5,6-diphenyl-1,2,4-triazine?
3-azido-5,6-diphenyl-1,2,4-triazine has a molecular weight of 274.29 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-5,6-diphenyl-1,2,4-triazine is sourced from PubChem (CID 15395171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).