About 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one
1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one (PubChem CID 15395303) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one |
| PubChem CID | 15395303 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one |
| SMILES | CC(C)N1CN(C)C(=O)N(C)C1 |
| InChI | InChI=1S/C8H17N3O/c1-7(2)11-5-9(3)8(12)10(4)6-11/h7H,5-6H2,1-4H3 |
| InChIKey | DVMWQISAQZIXRH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one?
The IUPAC name of 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one (CID 15395303) is 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one.
What is the SMILES notation for 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one?
The canonical SMILES for 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one is CC(C)N1CN(C)C(=O)N(C)C1.
What is the InChIKey of 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one?
The InChIKey is DVMWQISAQZIXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-7(2)11-5-9(3)8(12)10(4)6-11/h7H,5-6H2,1-4H3.
What are the key properties of 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one?
1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one has a molecular weight of 171.24 g/mol, XLogP of 0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-propan-2-yl-1,3,5-triazinan-2-one is sourced from PubChem (CID 15395303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).