C25H16F3NO2 — CID 15395548
(12E)-12-benzylideneindolo[2,1-a]isoquinolin-7-ium;2,2,2-trifluoroacetate (PubChem CID 15395548) has the molecular formula C25H16F3NO2 and a molecular weight of 419.40 g/mol. Its IUPAC name is (12E)-12-benzylideneindolo[2,1-a]isoquinolin-7-ium;2,2,2-trifluoroacetate.
| Compound Name | (12E)-12-benzylideneindolo[2,1-a]isoquinolin-7-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 15395548 |
| Molecular Formula | C25H16F3NO2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (12E)-12-benzylideneindolo[2,1-a]isoquinolin-7-ium;2,2,2-trifluoroacetate |
| SMILES | C(=C1\c2ccccc2-[n+]2ccc3ccccc3c21)\c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H16N.C2HF3O2/c1-2-8-17(9-3-1)16-21-20-12-6-7-13-22(20)24-15-14-18-10-4-5-11-19(18)23(21)24;3-2(4,5)1(6)7/h1-16H;(H,6,7)/q+1;/p-1/b21-16+; |
| InChIKey | TZLNLKFGYXTMLD-JEBHESKQSA-M |
| XLogP | 4.32 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|