C9F12 — CID 15395657
1,2,3,4,5-pentafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 15395657) has the molecular formula C9F12 and a molecular weight of 336.08 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 15395657 |
| Molecular Formula | C9F12 |
| Molecular Weight | 336.08 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | Fc1c(F)c(F)c(C(F)(C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C9F12/c10-2-1(3(11)5(13)6(14)4(2)12)7(15,8(16,17)18)9(19,20)21 |
| InChIKey | MESQHETYOOSPOO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.08 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|