C18H19NO2 — CID 15395997
(4R)-4-(2-phenylethyl)-3-phenylmethoxyazetidin-2-one (PubChem CID 15395997) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (4R)-4-(2-phenylethyl)-3-phenylmethoxyazetidin-2-one.
| Compound Name | (4R)-4-(2-phenylethyl)-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 15395997 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (4R)-4-(2-phenylethyl)-3-phenylmethoxyazetidin-2-one |
| SMILES | O=C1N[C@H](CCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c20-18-17(21-13-15-9-5-2-6-10-15)16(19-18)12-11-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2,(H,19,20)/t16-,17?/m1/s1 |
| InChIKey | CLSQLULUXAZPJU-TZHYSIJRSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |