About 2,4,6-trinitrobenzene-1,3-diamine
2,4,6-trinitrobenzene-1,3-diamine (PubChem CID 15396) has the molecular formula C6H5N5O6
and a molecular weight of 243.13 g/mol. Its IUPAC name is 2,4,6-trinitrobenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2,4,6-trinitrobenzene-1,3-diamine |
| PubChem CID | 15396 |
| Molecular Formula | C6H5N5O6 |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2,4,6-trinitrobenzene-1,3-diamine |
| SMILES | Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5N5O6/c7-4-2(9(12)13)1-3(10(14)15)5(8)6(4)11(16)17/h1H,7-8H2 |
| InChIKey | FZAZPMLWYUKRAE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trinitrobenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trinitrobenzene-1,3-diamine?
The IUPAC name of 2,4,6-trinitrobenzene-1,3-diamine (CID 15396) is 2,4,6-trinitrobenzene-1,3-diamine.
What is the SMILES notation for 2,4,6-trinitrobenzene-1,3-diamine?
The canonical SMILES for 2,4,6-trinitrobenzene-1,3-diamine is Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(N)c1[N+](=O)[O-].
What is the InChIKey of 2,4,6-trinitrobenzene-1,3-diamine?
The InChIKey is FZAZPMLWYUKRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O6/c7-4-2(9(12)13)1-3(10(14)15)5(8)6(4)11(16)17/h1H,7-8H2.
What are the key properties of 2,4,6-trinitrobenzene-1,3-diamine?
2,4,6-trinitrobenzene-1,3-diamine has a molecular weight of 243.13 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trinitrobenzene-1,3-diamine is sourced from PubChem (CID 15396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).