C34H32FN3O3 — CID 15396180
2-fluoro-5-[[(4R,5S,6S,7R)-3,4,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile (PubChem CID 15396180) has the molecular formula C34H32FN3O3 and a molecular weight of 549.65 g/mol. Its IUPAC name is 2-fluoro-5-[[(4R,5S,6S,7R)-3,4,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[(4R,5S,6S,7R)-3,4,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 15396180 |
| Molecular Formula | C34H32FN3O3 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 2-fluoro-5-[[(4R,5S,6S,7R)-3,4,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cc(CN2C(=O)N(Cc3ccccc3)[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)ccc1F |
| InChI | InChI=1S/C34H32FN3O3/c35-29-17-16-27(18-28(29)21-36)23-38-31(20-25-12-6-2-7-13-25)33(40)32(39)30(19-24-10-4-1-5-11-24)37(34(38)41)22-26-14-8-3-9-15-26/h1-18,30-33,39-40H,19-20,22-23H2/t30-,31-,32+,33+/m1/s1 |
| InChIKey | VPQSGKZFVBCJPW-FYZVQMPESA-N |
| XLogP | 5.08 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |