About 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide
2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide (PubChem CID 15396502) has the molecular formula C24H27N3O3
and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide.
Molecular Properties
| Compound Name | 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide |
| PubChem CID | 15396502 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide |
| SMILES | C#CCCNC(=O)Cc1cc(CC(=O)NCCC#C)cc(CC(=O)NCCC#C)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-4-7-10-25-22(28)16-19-13-20(17-23(29)26-11-8-5-2)15-21(14-19)18-24(30)27-12-9-6-3/h1-3,13-15H,7-12,16-18H2,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | IKHNEYXHUHJMEC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide?
The IUPAC name of 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide (CID 15396502) is 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide.
What is the SMILES notation for 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide?
The canonical SMILES for 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide is C#CCCNC(=O)Cc1cc(CC(=O)NCCC#C)cc(CC(=O)NCCC#C)c1.
What is the InChIKey of 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide?
The InChIKey is IKHNEYXHUHJMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O3/c1-4-7-10-25-22(28)16-19-13-20(17-23(29)26-11-8-5-2)15-21(14-19)18-24(30)27-12-9-6-3/h1-3,13-15H,7-12,16-18H2,(H,25,28)(H,26,29)(H,27,30).
What are the key properties of 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide?
2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide has a molecular weight of 405.50 g/mol, XLogP of 0.73, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis[2-(but-3-ynylamino)-2-oxoethyl]phenyl]-N-but-3-ynylacetamide is sourced from PubChem (CID 15396502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).