C15H28O3Si — CID 15396605
(3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-prop-2-enyloxolan-2-one (PubChem CID 15396605) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is (3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-prop-2-enyloxolan-2-one.
| Compound Name | (3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 15396605 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-prop-2-enyloxolan-2-one |
| SMILES | C=CC[C@H]1C(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C15H28O3Si/c1-8-9-12-11(2)13(18-14(12)16)10-17-19(6,7)15(3,4)5/h8,11-13H,1,9-10H2,2-7H3/t11-,12-,13-/m1/s1 |
| InChIKey | JBVUUQPCKQZGAA-JHJVBQTASA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|