About chlorogold;tris(2-methylphenyl)phosphane
chlorogold;tris(2-methylphenyl)phosphane (PubChem CID 15397758) has the molecular formula C21H21AuClP
and a molecular weight of 536.79 g/mol. Its IUPAC name is chlorogold;tris(2-methylphenyl)phosphane.
Molecular Properties
| Compound Name | chlorogold;tris(2-methylphenyl)phosphane |
| PubChem CID | 15397758 |
| Molecular Formula | C21H21AuClP |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | chlorogold;tris(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(c1ccccc1C)c1ccccc1C.Cl[Au] |
| InChI | InChI=1S/C21H21P.Au.ClH/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;;/h4-15H,1-3H3;;1H/q;+1;/p-1 |
| InChIKey | VECXLHSTZNCQLD-UHFFFAOYSA-M |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorogold;tris(2-methylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorogold;tris(2-methylphenyl)phosphane?
The IUPAC name of chlorogold;tris(2-methylphenyl)phosphane (CID 15397758) is chlorogold;tris(2-methylphenyl)phosphane.
What is the SMILES notation for chlorogold;tris(2-methylphenyl)phosphane?
The canonical SMILES for chlorogold;tris(2-methylphenyl)phosphane is Cc1ccccc1P(c1ccccc1C)c1ccccc1C.Cl[Au].
What is the InChIKey of chlorogold;tris(2-methylphenyl)phosphane?
The InChIKey is VECXLHSTZNCQLD-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H21P.Au.ClH/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;;/h4-15H,1-3H3;;1H/q;+1;/p-1.
What are the key properties of chlorogold;tris(2-methylphenyl)phosphane?
chlorogold;tris(2-methylphenyl)phosphane has a molecular weight of 536.79 g/mol, XLogP of 5.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorogold;tris(2-methylphenyl)phosphane is sourced from PubChem (CID 15397758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).