C11H11Br2F3O — CID 15398554
(1,2-dibromo-2-ethoxy-3,3,3-trifluoropropyl)benzene (PubChem CID 15398554) has the molecular formula C11H11Br2F3O and a molecular weight of 376.01 g/mol. Its IUPAC name is (1,2-dibromo-2-ethoxy-3,3,3-trifluoropropyl)benzene.
| Compound Name | (1,2-dibromo-2-ethoxy-3,3,3-trifluoropropyl)benzene |
|---|---|
| PubChem CID | 15398554 |
| Molecular Formula | C11H11Br2F3O |
| Molecular Weight | 376.01 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | (1,2-dibromo-2-ethoxy-3,3,3-trifluoropropyl)benzene |
| SMILES | CCOC(Br)(C(Br)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11Br2F3O/c1-2-17-10(13,11(14,15)16)9(12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3 |
| InChIKey | WJBLATCOYPSWIE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.01 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|