About (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide
(Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide (PubChem CID 15399687) has the molecular formula C15H26F3NO
and a molecular weight of 293.37 g/mol. Its IUPAC name is (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide.
Molecular Properties
| Compound Name | (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide |
| PubChem CID | 15399687 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide |
| SMILES | CCC/C=C(/C(=O)N(CCCC)CCCC)C(F)(F)F |
| InChI | InChI=1S/C15H26F3NO/c1-4-7-10-13(15(16,17)18)14(20)19(11-8-5-2)12-9-6-3/h10H,4-9,11-12H2,1-3H3/b13-10- |
| InChIKey | MIDWIRQIMCJDAR-RAXLEYEMSA-N |
| XLogP | 4.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide?
The IUPAC name of (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide (CID 15399687) is (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide.
What is the SMILES notation for (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide?
The canonical SMILES for (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide is CCC/C=C(/C(=O)N(CCCC)CCCC)C(F)(F)F.
What is the InChIKey of (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide?
The InChIKey is MIDWIRQIMCJDAR-RAXLEYEMSA-N. The full InChI is InChI=1S/C15H26F3NO/c1-4-7-10-13(15(16,17)18)14(20)19(11-8-5-2)12-9-6-3/h10H,4-9,11-12H2,1-3H3/b13-10-.
What are the key properties of (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide?
(Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide has a molecular weight of 293.37 g/mol, XLogP of 4.70, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dibutyl-2-(trifluoromethyl)hex-2-enamide is sourced from PubChem (CID 15399687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).