About (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide
(2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide (PubChem CID 15399691) has the molecular formula C15H24F3NO
and a molecular weight of 291.36 g/mol. Its IUPAC name is (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide.
Molecular Properties
| Compound Name | (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide |
| PubChem CID | 15399691 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide |
| SMILES | C=C(C)/C=C(/C(=O)N(CCCC)CCCC)C(F)(F)F |
| InChI | InChI=1S/C15H24F3NO/c1-5-7-9-19(10-8-6-2)14(20)13(11-12(3)4)15(16,17)18/h11H,3,5-10H2,1-2,4H3/b13-11- |
| InChIKey | YXKMJWPBORRZIX-QBFSEMIESA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide?
The IUPAC name of (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide (CID 15399691) is (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide.
What is the SMILES notation for (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide?
The canonical SMILES for (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide is C=C(C)/C=C(/C(=O)N(CCCC)CCCC)C(F)(F)F.
What is the InChIKey of (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide?
The InChIKey is YXKMJWPBORRZIX-QBFSEMIESA-N. The full InChI is InChI=1S/C15H24F3NO/c1-5-7-9-19(10-8-6-2)14(20)13(11-12(3)4)15(16,17)18/h11H,3,5-10H2,1-2,4H3/b13-11-.
What are the key properties of (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide?
(2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide has a molecular weight of 291.36 g/mol, XLogP of 4.48, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N,N-dibutyl-4-methyl-2-(trifluoromethyl)penta-2,4-dienamide is sourced from PubChem (CID 15399691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).