About 1-(1-adamantyl)-4,5-dinitroimidazole
1-(1-adamantyl)-4,5-dinitroimidazole (PubChem CID 15399799) has the molecular formula C13H16N4O4
and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-(1-adamantyl)-4,5-dinitroimidazole.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-4,5-dinitroimidazole |
| PubChem CID | 15399799 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-(1-adamantyl)-4,5-dinitroimidazole |
| SMILES | O=[N+]([O-])c1ncn(C23CC4CC(CC(C4)C2)C3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O4/c18-16(19)11-12(17(20)21)15(7-14-11)13-4-8-1-9(5-13)3-10(2-8)6-13/h7-10H,1-6H2 |
| InChIKey | JJSYNBNSVJKPJL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantyl)-4,5-dinitroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-4,5-dinitroimidazole?
The IUPAC name of 1-(1-adamantyl)-4,5-dinitroimidazole (CID 15399799) is 1-(1-adamantyl)-4,5-dinitroimidazole.
What is the SMILES notation for 1-(1-adamantyl)-4,5-dinitroimidazole?
The canonical SMILES for 1-(1-adamantyl)-4,5-dinitroimidazole is O=[N+]([O-])c1ncn(C23CC4CC(CC(C4)C2)C3)c1[N+](=O)[O-].
What is the InChIKey of 1-(1-adamantyl)-4,5-dinitroimidazole?
The InChIKey is JJSYNBNSVJKPJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O4/c18-16(19)11-12(17(20)21)15(7-14-11)13-4-8-1-9(5-13)3-10(2-8)6-13/h7-10H,1-6H2.
What are the key properties of 1-(1-adamantyl)-4,5-dinitroimidazole?
1-(1-adamantyl)-4,5-dinitroimidazole has a molecular weight of 292.30 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-4,5-dinitroimidazole is sourced from PubChem (CID 15399799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).