C36H32O8 — CID 15399909
3,12,19,28-tetraoxapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene-4,11,20,27-tetrone (PubChem CID 15399909) has the molecular formula C36H32O8 and a molecular weight of 592.64 g/mol. Its IUPAC name is 3,12,19,28-tetraoxapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene-4,11,20,27-tetrone.
| Compound Name | 3,12,19,28-tetraoxapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene-4,11,20,27-tetrone |
|---|---|
| PubChem CID | 15399909 |
| Molecular Formula | C36H32O8 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 3,12,19,28-tetraoxapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene-4,11,20,27-tetrone |
| SMILES | O=C1Cc2ccc(cc2)CC(=O)OCc2ccc(cc2)COC(=O)Cc2ccc(cc2)CC(=O)OCc2ccc(cc2)CO1 |
| InChI | InChI=1S/C36H32O8/c37-33-17-25-1-2-26(4-3-25)18-34(38)42-22-30-13-15-32(16-14-30)24-44-36(40)20-28-7-5-27(6-8-28)19-35(39)43-23-31-11-9-29(10-12-31)21-41-33/h1-16H,17-24H2 |
| InChIKey | WTEPQODFQQGZOY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|