C18H25F3N2O2 — CID 154001119
1-[(2S,5R)-2-tert-butyl-5-(phenylmethoxyamino)piperidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 154001119) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[(2S,5R)-2-tert-butyl-5-(phenylmethoxyamino)piperidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2S,5R)-2-tert-butyl-5-(phenylmethoxyamino)piperidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 154001119 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[(2S,5R)-2-tert-butyl-5-(phenylmethoxyamino)piperidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O2/c1-17(2,3)15-10-9-14(11-23(15)16(24)18(19,20)21)22-25-12-13-7-5-4-6-8-13/h4-8,14-15,22H,9-12H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | GWLGFQHHSGVSAU-CABCVRRESA-N |
| XLogP | 3.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|