About 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole
3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole (PubChem CID 154002561) has the molecular formula C15H17N3
and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole |
| PubChem CID | 154002561 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole |
| SMILES | Cc1ncc(-c2ccc3c(c2)NCC3(C)C)cn1 |
| InChI | InChI=1S/C15H17N3/c1-10-16-7-12(8-17-10)11-4-5-13-14(6-11)18-9-15(13,2)3/h4-8,18H,9H2,1-3H3 |
| InChIKey | SBZPMGVWNQHDFR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole?
The IUPAC name of 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole (CID 154002561) is 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole.
What is the SMILES notation for 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole?
The canonical SMILES for 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole is Cc1ncc(-c2ccc3c(c2)NCC3(C)C)cn1.
What is the InChIKey of 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole?
The InChIKey is SBZPMGVWNQHDFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3/c1-10-16-7-12(8-17-10)11-4-5-13-14(6-11)18-9-15(13,2)3/h4-8,18H,9H2,1-3H3.
What are the key properties of 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole?
3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole has a molecular weight of 239.32 g/mol, XLogP of 3.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1,2-dihydroindole is sourced from PubChem (CID 154002561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).