C15H14O10S2 — CID 154002807
3-benzoyl-4-hydroxy-5,6-dimethoxybenzene-1,2-disulfonic acid (PubChem CID 154002807) has the molecular formula C15H14O10S2 and a molecular weight of 418.40 g/mol. Its IUPAC name is 3-benzoyl-4-hydroxy-5,6-dimethoxybenzene-1,2-disulfonic acid.
| Compound Name | 3-benzoyl-4-hydroxy-5,6-dimethoxybenzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 154002807 |
| Molecular Formula | C15H14O10S2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 3-benzoyl-4-hydroxy-5,6-dimethoxybenzene-1,2-disulfonic acid |
| SMILES | COc1c(O)c(C(=O)c2ccccc2)c(S(=O)(=O)O)c(S(=O)(=O)O)c1OC |
| InChI | InChI=1S/C15H14O10S2/c1-24-12-11(17)9(10(16)8-6-4-3-5-7-8)14(26(18,19)20)15(13(12)25-2)27(21,22)23/h3-7,17H,1-2H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | RPXYSYWADDYGJM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|