C16H28O4S — CID 154004350
(4R)-4-butyl-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]cyclohexa-2,5-diene-1-sulfonic acid (PubChem CID 154004350) has the molecular formula C16H28O4S and a molecular weight of 316.46 g/mol. Its IUPAC name is (4R)-4-butyl-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]cyclohexa-2,5-diene-1-sulfonic acid.
| Compound Name | (4R)-4-butyl-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]cyclohexa-2,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 154004350 |
| Molecular Formula | C16H28O4S |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (4R)-4-butyl-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]cyclohexa-2,5-diene-1-sulfonic acid |
| SMILES | CCCC[C@]1(C)C=CC(OC(C)(C)C)(S(=O)(=O)O)C(C)=C1 |
| InChI | InChI=1S/C16H28O4S/c1-7-8-9-15(6)10-11-16(13(2)12-15,21(17,18)19)20-14(3,4)5/h10-12H,7-9H2,1-6H3,(H,17,18,19)/t15-,16?/m1/s1 |
| InChIKey | PAEMYDFEJQVXFZ-AAFJCEBUSA-N |
| XLogP | 4.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|