C20H23N5 — CID 15400557
2,9,9,15,15-pentamethyl-5,6,12,18,19-pentazapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),2,4(8),6,11,16(20),17-heptaene (PubChem CID 15400557) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 2,9,9,15,15-pentamethyl-5,6,12,18,19-pentazapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),2,4(8),6,11,16(20),17-heptaene.
| Compound Name | 2,9,9,15,15-pentamethyl-5,6,12,18,19-pentazapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),2,4(8),6,11,16(20),17-heptaene |
|---|---|
| PubChem CID | 15400557 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2,9,9,15,15-pentamethyl-5,6,12,18,19-pentazapentacyclo[11.7.0.03,11.04,8.016,20]icosa-1(13),2,4(8),6,11,16(20),17-heptaene |
| SMILES | Cc1c2c(nc3c1-c1[nH]ncc1C(C)(C)C3)CC(C)(C)c1cn[nH]c1-2 |
| InChI | InChI=1S/C20H23N5/c1-10-15-13(6-19(2,3)11-8-21-24-17(11)15)23-14-7-20(4,5)12-9-22-25-18(12)16(10)14/h8-9H,6-7H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | TYKXGJJOPDAEJL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |