C8H10F3NO — CID 154006651
(2Z,4E)-1,1,1-trifluoro-5-methoxyhepta-2,4,6-trien-2-amine (PubChem CID 154006651) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is (2Z,4E)-1,1,1-trifluoro-5-methoxyhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4E)-1,1,1-trifluoro-5-methoxyhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 154006651 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (2Z,4E)-1,1,1-trifluoro-5-methoxyhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/N)C(F)(F)F)OC |
| InChI | InChI=1S/C8H10F3NO/c1-3-6(13-2)4-5-7(12)8(9,10)11/h3-5H,1,12H2,2H3/b6-4+,7-5- |
| InChIKey | RVRXEGWGPFSYBR-GUBXDBFYSA-N |
| XLogP | 2.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|